C12H15NO6 — CID 171897479
3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)pyridine-4-carboxylic acid (PubChem CID 171897479) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)pyridine-4-carboxylic acid.
| Compound Name | 3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 171897479 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 3-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)pyridine-4-carboxylic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1cnccc1C(=O)O |
| InChI | InChI=1S/C12H15NO6/c1-2-19-10(15)5-9(14)11(16)8-6-13-4-3-7(8)12(17)18/h3-4,6,9,11,14,16H,2,5H2,1H3,(H,17,18) |
| InChIKey | GWHATRSGZVQIBV-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |