C11H13NO5S — CID 170822031
3-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-4-carboxylic acid (PubChem CID 170822031) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-4-carboxylic acid.
| Compound Name | 3-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 170822031 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-4-carboxylic acid |
| SMILES | CC(=O)SCC(O)C(O)c1cnccc1C(=O)O |
| InChI | InChI=1S/C11H13NO5S/c1-6(13)18-5-9(14)10(15)8-4-12-3-2-7(8)11(16)17/h2-4,9-10,14-15H,5H2,1H3,(H,16,17) |
| InChIKey | ULULRJGKAHPPQU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|