C11H12ClNO5S — CID 170822358
5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-chloropyridine-3-carboxylic acid (PubChem CID 170822358) has the molecular formula C11H12ClNO5S and a molecular weight of 305.74 g/mol. Its IUPAC name is 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-chloropyridine-3-carboxylic acid.
| Compound Name | 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-chloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170822358 |
| Molecular Formula | C11H12ClNO5S |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-chloropyridine-3-carboxylic acid |
| SMILES | CC(=O)SCC(O)C(O)c1cnc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H12ClNO5S/c1-5(14)19-4-8(15)9(16)6-2-7(11(17)18)10(12)13-3-6/h2-3,8-9,15-16H,4H2,1H3,(H,17,18) |
| InChIKey | SULWYDOWJUNBPF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|