C10H11BrClNO3S — CID 170823036
S-[3-(5-bromo-2-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate (PubChem CID 170823036) has the molecular formula C10H11BrClNO3S and a molecular weight of 340.63 g/mol. Its IUPAC name is S-[3-(5-bromo-2-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate.
| Compound Name | S-[3-(5-bromo-2-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
|---|---|
| PubChem CID | 170823036 |
| Molecular Formula | C10H11BrClNO3S |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 338.93 |
| IUPAC Name | S-[3-(5-bromo-2-chloro-3-pyridinyl)-2,3-dihydroxypropyl] ethanethioate |
| SMILES | CC(=O)SCC(O)C(O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H11BrClNO3S/c1-5(14)17-4-8(15)9(16)7-2-6(11)3-13-10(7)12/h2-3,8-9,15-16H,4H2,1H3 |
| InChIKey | WAVNIOSSLZSPQA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|