C12H14FNO5S — CID 170822598
methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate (PubChem CID 170822598) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate.
| Compound Name | methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 170822598 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)-2-fluoropyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C(O)C(O)CSC(C)=O)cnc1F |
| InChI | InChI=1S/C12H14FNO5S/c1-6(15)20-5-9(16)10(17)7-3-8(12(18)19-2)11(13)14-4-7/h3-4,9-10,16-17H,5H2,1-2H3 |
| InChIKey | FXRGYMPGMOFFHJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|