C12H15NO5S — CID 170822386
methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-3-carboxylate (PubChem CID 170822386) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170822386 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | methyl 5-(3-acetylsulfanyl-1,2-dihydroxypropyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(C(O)C(O)CSC(C)=O)c1 |
| InChI | InChI=1S/C12H15NO5S/c1-7(14)19-6-10(15)11(16)8-3-9(5-13-4-8)12(17)18-2/h3-5,10-11,15-16H,6H2,1-2H3 |
| InChIKey | TVXINPQJIMWEQE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|