C9H11NO5 — CID 170817946
5-(1,2,3-trihydroxypropyl)pyridine-3-carboxylic acid (PubChem CID 170817946) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 5-(1,2,3-trihydroxypropyl)pyridine-3-carboxylic acid.
| Compound Name | 5-(1,2,3-trihydroxypropyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170817946 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 5-(1,2,3-trihydroxypropyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cncc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C9H11NO5/c11-4-7(12)8(13)5-1-6(9(14)15)3-10-2-5/h1-3,7-8,11-13H,4H2,(H,14,15) |
| InChIKey | LBMOULFJBOFARI-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |