C10H13NO5 — CID 170818309
3-amino-5-(1,2,3-trihydroxypropyl)benzoic acid (PubChem CID 170818309) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-amino-5-(1,2,3-trihydroxypropyl)benzoic acid.
| Compound Name | 3-amino-5-(1,2,3-trihydroxypropyl)benzoic acid |
|---|---|
| PubChem CID | 170818309 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-amino-5-(1,2,3-trihydroxypropyl)benzoic acid |
| SMILES | Nc1cc(C(=O)O)cc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C10H13NO5/c11-7-2-5(9(14)8(13)4-12)1-6(3-7)10(15)16/h1-3,8-9,12-14H,4,11H2,(H,15,16) |
| InChIKey | IUAQJHIZIAWDHM-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|