C12H15NO6 — CID 171878356
4-(3-amino-5-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171878356) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is 4-(3-amino-5-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(3-amino-5-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878356 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 4-(3-amino-5-methoxycarbonylphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | COC(=O)c1cc(N)cc(C(O)C(O)CC(=O)O)c1 |
| InChI | InChI=1S/C12H15NO6/c1-19-12(18)7-2-6(3-8(13)4-7)11(17)9(14)5-10(15)16/h2-4,9,11,14,17H,5,13H2,1H3,(H,15,16) |
| InChIKey | JNDHWZUONYMRSQ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|