C14H20N2O5 — CID 171883730
methyl 3-(4-acetamido-1,2-dihydroxybutyl)-5-aminobenzoate (PubChem CID 171883730) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is methyl 3-(4-acetamido-1,2-dihydroxybutyl)-5-aminobenzoate.
| Compound Name | methyl 3-(4-acetamido-1,2-dihydroxybutyl)-5-aminobenzoate |
|---|---|
| PubChem CID | 171883730 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | methyl 3-(4-acetamido-1,2-dihydroxybutyl)-5-aminobenzoate |
| SMILES | COC(=O)c1cc(N)cc(C(O)C(O)CCNC(C)=O)c1 |
| InChI | InChI=1S/C14H20N2O5/c1-8(17)16-4-3-12(18)13(19)9-5-10(14(20)21-2)7-11(15)6-9/h5-7,12-13,18-19H,3-4,15H2,1-2H3,(H,16,17) |
| InChIKey | DCHKHVSDLDRWAX-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|