C12H18N2O4 — CID 171858622
methyl 3-amino-5-[1,2-dihydroxy-3-(methylamino)propyl]benzoate (PubChem CID 171858622) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 3-amino-5-[1,2-dihydroxy-3-(methylamino)propyl]benzoate.
| Compound Name | methyl 3-amino-5-[1,2-dihydroxy-3-(methylamino)propyl]benzoate |
|---|---|
| PubChem CID | 171858622 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | methyl 3-amino-5-[1,2-dihydroxy-3-(methylamino)propyl]benzoate |
| SMILES | CNCC(O)C(O)c1cc(N)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C12H18N2O4/c1-14-6-10(15)11(16)7-3-8(12(17)18-2)5-9(13)4-7/h3-5,10-11,14-16H,6,13H2,1-2H3 |
| InChIKey | HZCSDTHRPQLXTP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|