C11H15ClN2O4 — CID 171858607
methyl 6-chloro-5-[1,2-dihydroxy-3-(methylamino)propyl]pyridine-3-carboxylate (PubChem CID 171858607) has the molecular formula C11H15ClN2O4 and a molecular weight of 274.70 g/mol. Its IUPAC name is methyl 6-chloro-5-[1,2-dihydroxy-3-(methylamino)propyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-chloro-5-[1,2-dihydroxy-3-(methylamino)propyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 171858607 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | methyl 6-chloro-5-[1,2-dihydroxy-3-(methylamino)propyl]pyridine-3-carboxylate |
| SMILES | CNCC(O)C(O)c1cc(C(=O)OC)cnc1Cl |
| InChI | InChI=1S/C11H15ClN2O4/c1-13-5-8(15)9(16)7-3-6(11(17)18-2)4-14-10(7)12/h3-4,8-9,13,15-16H,5H2,1-2H3 |
| InChIKey | ARBSKOVEJTVUFG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|