C10H10ClNO6 — CID 170824623
3-(2-chloro-5-methoxycarbonyl-3-pyridinyl)-2,3-dihydroxypropanoic acid (PubChem CID 170824623) has the molecular formula C10H10ClNO6 and a molecular weight of 275.64 g/mol. Its IUPAC name is 3-(2-chloro-5-methoxycarbonyl-3-pyridinyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(2-chloro-5-methoxycarbonyl-3-pyridinyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170824623 |
| Molecular Formula | C10H10ClNO6 |
| Molecular Weight | 275.64 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-(2-chloro-5-methoxycarbonyl-3-pyridinyl)-2,3-dihydroxypropanoic acid |
| SMILES | COC(=O)c1cnc(Cl)c(C(O)C(O)C(=O)O)c1 |
| InChI | InChI=1S/C10H10ClNO6/c1-18-10(17)4-2-5(8(11)12-3-4)6(13)7(14)9(15)16/h2-3,6-7,13-14H,1H3,(H,15,16) |
| InChIKey | ITFXJVXGZDDUDN-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.64 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|