C8H7Cl2NO4 — CID 170823721
3-(2,5-dichloro-3-pyridinyl)-2,3-dihydroxypropanoic acid (PubChem CID 170823721) has the molecular formula C8H7Cl2NO4 and a molecular weight of 252.05 g/mol. Its IUPAC name is 3-(2,5-dichloro-3-pyridinyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(2,5-dichloro-3-pyridinyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823721 |
| Molecular Formula | C8H7Cl2NO4 |
| Molecular Weight | 252.05 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 3-(2,5-dichloro-3-pyridinyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1cc(Cl)cnc1Cl |
| InChI | InChI=1S/C8H7Cl2NO4/c9-3-1-4(7(10)11-2-3)5(12)6(13)8(14)15/h1-2,5-6,12-13H,(H,14,15) |
| InChIKey | ZFCHUWXYJRXIQC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.05 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|