C7H6Cl2N2O4 — CID 170823653
3-(2,4-dichloropyrimidin-5-yl)-2,3-dihydroxypropanoic acid (PubChem CID 170823653) has the molecular formula C7H6Cl2N2O4 and a molecular weight of 253.04 g/mol. Its IUPAC name is 3-(2,4-dichloropyrimidin-5-yl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(2,4-dichloropyrimidin-5-yl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823653 |
| Molecular Formula | C7H6Cl2N2O4 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | 3-(2,4-dichloropyrimidin-5-yl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C7H6Cl2N2O4/c8-5-2(1-10-7(9)11-5)3(12)4(13)6(14)15/h1,3-4,12-13H,(H,14,15) |
| InChIKey | WSIZPQFJEFMRED-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |