C10H13Cl2N3O3 — CID 171882730
N-[4-(2,4-dichloropyrimidin-5-yl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882730) has the molecular formula C10H13Cl2N3O3 and a molecular weight of 294.14 g/mol. Its IUPAC name is N-[4-(2,4-dichloropyrimidin-5-yl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(2,4-dichloropyrimidin-5-yl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882730 |
| Molecular Formula | C10H13Cl2N3O3 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | N-[4-(2,4-dichloropyrimidin-5-yl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cnc(Cl)nc1Cl |
| InChI | InChI=1S/C10H13Cl2N3O3/c1-5(16)13-3-2-7(17)8(18)6-4-14-10(12)15-9(6)11/h4,7-8,17-18H,2-3H2,1H3,(H,13,16) |
| InChIKey | UOPUOXRSFGHGOC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |