C11H16ClN3O3 — CID 171882686
N-[4-(4-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutyl]acetamide (PubChem CID 171882686) has the molecular formula C11H16ClN3O3 and a molecular weight of 273.72 g/mol. Its IUPAC name is N-[4-(4-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutyl]acetamide.
| Compound Name | N-[4-(4-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutyl]acetamide |
|---|---|
| PubChem CID | 171882686 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-[4-(4-amino-6-chloro-3-pyridinyl)-3,4-dihydroxybutyl]acetamide |
| SMILES | CC(=O)NCCC(O)C(O)c1cnc(Cl)cc1N |
| InChI | InChI=1S/C11H16ClN3O3/c1-6(16)14-3-2-9(17)11(18)7-5-15-10(12)4-8(7)13/h4-5,9,11,17-18H,2-3H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | XDBXLVUJBVJCAY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|