C8H11ClN2O2S — CID 170819513
1-(4-amino-6-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819513) has the molecular formula C8H11ClN2O2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 1-(4-amino-6-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(4-amino-6-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819513 |
| Molecular Formula | C8H11ClN2O2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 1-(4-amino-6-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol |
| SMILES | Nc1cc(Cl)ncc1C(O)C(O)CS |
| InChI | InChI=1S/C8H11ClN2O2S/c9-7-1-5(10)4(2-11-7)8(13)6(12)3-14/h1-2,6,8,12-14H,3H2,(H2,10,11) |
| InChIKey | STCZNFVQPOPEJI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|