C8H12N2O2S — CID 170819333
1-(4-amino-2-pyridinyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819333) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 1-(4-amino-2-pyridinyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(4-amino-2-pyridinyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819333 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 1-(4-amino-2-pyridinyl)-3-sulfanylpropane-1,2-diol |
| SMILES | Nc1ccnc(C(O)C(O)CS)c1 |
| InChI | InChI=1S/C8H12N2O2S/c9-5-1-2-10-6(3-5)8(12)7(11)4-13/h1-3,7-8,11-13H,4H2,(H2,9,10) |
| InChIKey | UTALDXKKCQRDOX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|