C9H13NO4 — CID 170817640
1-[4-(hydroxymethyl)-2-pyridinyl]propane-1,2,3-triol (PubChem CID 170817640) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-2-pyridinyl]propane-1,2,3-triol.
| Compound Name | 1-[4-(hydroxymethyl)-2-pyridinyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817640 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-[4-(hydroxymethyl)-2-pyridinyl]propane-1,2,3-triol |
| SMILES | OCc1ccnc(C(O)C(O)CO)c1 |
| InChI | InChI=1S/C9H13NO4/c11-4-6-1-2-10-7(3-6)9(14)8(13)5-12/h1-3,8-9,11-14H,4-5H2 |
| InChIKey | XIPAEYVNTZUBGX-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |