C10H14N2O — CID 55277194
[2-[(R)-amino(cyclopropyl)methyl]-4-pyridinyl]methanol (PubChem CID 55277194) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is [2-[(R)-amino(cyclopropyl)methyl]-4-pyridinyl]methanol.
| Compound Name | [2-[(R)-amino(cyclopropyl)methyl]-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 55277194 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | [2-[(R)-amino(cyclopropyl)methyl]-4-pyridinyl]methanol |
| SMILES | N[C@@H](c1cc(CO)ccn1)C1CC1 |
| InChI | InChI=1S/C10H14N2O/c11-10(8-1-2-8)9-5-7(6-13)3-4-12-9/h3-5,8,10,13H,1-2,6,11H2/t10-/m1/s1 |
| InChIKey | WXHAQIZTTWXCFP-SNVBAGLBSA-N |
| XLogP | 0.98 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |