C8H10ClNO2S — CID 170819352
1-(2-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170819352) has the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. Its IUPAC name is 1-(2-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(2-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170819352 |
| Molecular Formula | C8H10ClNO2S |
| Molecular Weight | 219.69 g/mol |
| Exact Mass | 219.01 |
| IUPAC Name | 1-(2-chloro-3-pyridinyl)-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1cccnc1Cl |
| InChI | InChI=1S/C8H10ClNO2S/c9-8-5(2-1-3-10-8)7(12)6(11)4-13/h1-3,6-7,11-13H,4H2 |
| InChIKey | WIABTBZDWLXADM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.69 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|