C9H10N2O2S — CID 170819530
3-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbonitrile (PubChem CID 170819530) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 3-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbonitrile.
| Compound Name | 3-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 170819530 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 3-(1,2-dihydroxy-3-sulfanylpropyl)pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1C(O)C(O)CS |
| InChI | InChI=1S/C9H10N2O2S/c10-4-7-6(2-1-3-11-7)9(13)8(12)5-14/h1-3,8-9,12-14H,5H2 |
| InChIKey | XIDZFTSOHGZZKP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|