C9H10F3NO3 — CID 170818245
1-[2-(trifluoromethyl)-3-pyridinyl]propane-1,2,3-triol (PubChem CID 170818245) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)-3-pyridinyl]propane-1,2,3-triol.
| Compound Name | 1-[2-(trifluoromethyl)-3-pyridinyl]propane-1,2,3-triol |
|---|---|
| PubChem CID | 170818245 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 1-[2-(trifluoromethyl)-3-pyridinyl]propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1cccnc1C(F)(F)F |
| InChI | InChI=1S/C9H10F3NO3/c10-9(11,12)8-5(2-1-3-13-8)7(16)6(15)4-14/h1-3,6-7,14-16H,4H2 |
| InChIKey | IUMVAHVNALHFBF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |