C9H12F3N3O3 — CID 171873020
1-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]butane-1,2,4-triol (PubChem CID 171873020) has the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is 1-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]butane-1,2,4-triol.
| Compound Name | 1-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873020 |
| Molecular Formula | C9H12F3N3O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-[2-amino-4-(trifluoromethyl)pyrimidin-5-yl]butane-1,2,4-triol |
| SMILES | Nc1ncc(C(O)C(O)CCO)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H12F3N3O3/c10-9(11,12)7-4(3-14-8(13)15-7)6(18)5(17)1-2-16/h3,5-6,16-18H,1-2H2,(H2,13,14,15) |
| InChIKey | OSCLYTCVQCZLQD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |