C8H13N3O3 — CID 170817665
1-(2-amino-4-methylpyrimidin-5-yl)propane-1,2,3-triol (PubChem CID 170817665) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(2-amino-4-methylpyrimidin-5-yl)propane-1,2,3-triol.
| Compound Name | 1-(2-amino-4-methylpyrimidin-5-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817665 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(2-amino-4-methylpyrimidin-5-yl)propane-1,2,3-triol |
| SMILES | Cc1nc(N)ncc1C(O)C(O)CO |
| InChI | InChI=1S/C8H13N3O3/c1-4-5(2-10-8(9)11-4)7(14)6(13)3-12/h2,6-7,12-14H,3H2,1H3,(H2,9,10,11) |
| InChIKey | CYXGPSUMCQTLKW-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |