C8H10ClN3O4 — CID 171877478
4-(2-amino-4-chloropyrimidin-5-yl)-3,4-dihydroxybutanoic acid (PubChem CID 171877478) has the molecular formula C8H10ClN3O4 and a molecular weight of 247.64 g/mol. Its IUPAC name is 4-(2-amino-4-chloropyrimidin-5-yl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(2-amino-4-chloropyrimidin-5-yl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877478 |
| Molecular Formula | C8H10ClN3O4 |
| Molecular Weight | 247.64 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-(2-amino-4-chloropyrimidin-5-yl)-3,4-dihydroxybutanoic acid |
| SMILES | Nc1ncc(C(O)C(O)CC(=O)O)c(Cl)n1 |
| InChI | InChI=1S/C8H10ClN3O4/c9-7-3(2-11-8(10)12-7)6(16)4(13)1-5(14)15/h2,4,6,13,16H,1H2,(H,14,15)(H2,10,11,12) |
| InChIKey | RCNINQNDHHFHOC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.64 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |