C10H10Cl2O5 — CID 171877633
4-(2,5-dichloro-4-hydroxyphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877633) has the molecular formula C10H10Cl2O5 and a molecular weight of 281.09 g/mol. Its IUPAC name is 4-(2,5-dichloro-4-hydroxyphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(2,5-dichloro-4-hydroxyphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877633 |
| Molecular Formula | C10H10Cl2O5 |
| Molecular Weight | 281.09 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 4-(2,5-dichloro-4-hydroxyphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1cc(Cl)c(O)cc1Cl |
| InChI | InChI=1S/C10H10Cl2O5/c11-5-2-7(13)6(12)1-4(5)10(17)8(14)3-9(15)16/h1-2,8,10,13-14,17H,3H2,(H,15,16) |
| InChIKey | WEKTVCBHEWHURZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.09 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |