C11H10ClNO4 — CID 171877710
4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877710) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877710 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid |
| SMILES | N#Cc1ccc(Cl)cc1C(O)C(O)CC(=O)O |
| InChI | InChI=1S/C11H10ClNO4/c12-7-2-1-6(5-13)8(3-7)11(17)9(14)4-10(15)16/h1-3,9,11,14,17H,4H2,(H,15,16) |
| InChIKey | WZIDGUCSFQBPLL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |