4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid

C11H10ClNO4 — CID 171877710

IUPAC4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid
SMILESN#Cc1ccc(Cl)cc1C(O)C(O)CC(=O)O
InChIInChI=1S/C11H10ClNO4/c12-7-2-1-6(5-13)8(3-7)11(17)9(14)4-10(15)16/h1-3,9,11,14,17H,4H2,(H,15,16)
InChIKeyWZIDGUCSFQBPLL-UHFFFAOYSA-N
MW255.66 g/mol
LogP1.08
Rot. Bonds4

About 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid

4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877710) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid.

Molecular Properties

Compound Name4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid
PubChem CID171877710
Molecular FormulaC11H10ClNO4
Molecular Weight255.66 g/mol
Exact Mass255.03
IUPAC Name4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid
SMILESN#Cc1ccc(Cl)cc1C(O)C(O)CC(=O)O
InChIInChI=1S/C11H10ClNO4/c12-7-2-1-6(5-13)8(3-7)11(17)9(14)4-10(15)16/h1-3,9,11,14,17H,4H2,(H,15,16)
InChIKeyWZIDGUCSFQBPLL-UHFFFAOYSA-N
XLogP1.08
TPSA101.55 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.66
LogP ≤ 51.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid?
The IUPAC name of 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid (CID 171877710) is 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid.
What is the SMILES notation for 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid?
The canonical SMILES for 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid is N#Cc1ccc(Cl)cc1C(O)C(O)CC(=O)O.
What is the InChIKey of 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid?
The InChIKey is WZIDGUCSFQBPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO4/c12-7-2-1-6(5-13)8(3-7)11(17)9(14)4-10(15)16/h1-3,9,11,14,17H,4H2,(H,15,16).
What are the key properties of 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid?
4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid has a molecular weight of 255.66 g/mol, XLogP of 1.08, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chloro-2-cyanophenyl)-3,4-dihydroxybutanoic acid is sourced from PubChem (CID 171877710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).