C11H12N2O4 — CID 171877657
4-(5-amino-2-cyanophenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877657) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 4-(5-amino-2-cyanophenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(5-amino-2-cyanophenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877657 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-(5-amino-2-cyanophenyl)-3,4-dihydroxybutanoic acid |
| SMILES | N#Cc1ccc(N)cc1C(O)C(O)CC(=O)O |
| InChI | InChI=1S/C11H12N2O4/c12-5-6-1-2-7(13)3-8(6)11(17)9(14)4-10(15)16/h1-3,9,11,14,17H,4,13H2,(H,15,16) |
| InChIKey | YEPKXGXJLCFBHL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|