C10H10N2O5 — CID 171877672
4-(5-cyano-6-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutanoic acid (PubChem CID 171877672) has the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. Its IUPAC name is 4-(5-cyano-6-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(5-cyano-6-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877672 |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 4-(5-cyano-6-oxo-1H-pyridin-3-yl)-3,4-dihydroxybutanoic acid |
| SMILES | N#Cc1cc(C(O)C(O)CC(=O)O)c[nH]c1=O |
| InChI | InChI=1S/C10H10N2O5/c11-3-5-1-6(4-12-10(5)17)9(16)7(13)2-8(14)15/h1,4,7,9,13,16H,2H2,(H,12,17)(H,14,15) |
| InChIKey | AOUSRPLPHNAZFT-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |