C10H10Cl3NO5 — CID 171878370
3,4-dihydroxy-4-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]butanoic acid (PubChem CID 171878370) has the molecular formula C10H10Cl3NO5 and a molecular weight of 330.55 g/mol. Its IUPAC name is 3,4-dihydroxy-4-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]butanoic acid.
| Compound Name | 3,4-dihydroxy-4-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 171878370 |
| Molecular Formula | C10H10Cl3NO5 |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 3,4-dihydroxy-4-[5-(2,2,2-trichloroacetyl)-1H-pyrrol-3-yl]butanoic acid |
| SMILES | O=C(O)CC(O)C(O)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C10H10Cl3NO5/c11-10(12,13)9(19)5-1-4(3-14-5)8(18)6(15)2-7(16)17/h1,3,6,8,14-15,18H,2H2,(H,16,17) |
| InChIKey | HEPKPZNAHCKLIW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|