C10H12Cl3NO4 — CID 171872995
2,2,2-trichloro-1-[4-(1,2,4-trihydroxybutyl)-1H-pyrrol-2-yl]ethanone (PubChem CID 171872995) has the molecular formula C10H12Cl3NO4 and a molecular weight of 316.57 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-(1,2,4-trihydroxybutyl)-1H-pyrrol-2-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-(1,2,4-trihydroxybutyl)-1H-pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 171872995 |
| Molecular Formula | C10H12Cl3NO4 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 2,2,2-trichloro-1-[4-(1,2,4-trihydroxybutyl)-1H-pyrrol-2-yl]ethanone |
| SMILES | O=C(c1cc(C(O)C(O)CCO)c[nH]1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C10H12Cl3NO4/c11-10(12,13)9(18)6-3-5(4-14-6)8(17)7(16)1-2-15/h3-4,7-8,14-17H,1-2H2 |
| InChIKey | DCVXFFUALGWECR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|