methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate

C12H15ClO5 — CID 171872848

IUPACmethyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate
SMILESCOC(=O)c1cc(C(O)C(O)CCO)ccc1Cl
InChIInChI=1S/C12H15ClO5/c1-18-12(17)8-6-7(2-3-9(8)13)11(16)10(15)4-5-14/h2-3,6,10-11,14-16H,4-5H2,1H3
InChIKeyZRSLLEHIVPVPEZ-UHFFFAOYSA-N
MW274.70 g/mol
LogP0.90
Rot. Bonds5

About methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate

methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate (PubChem CID 171872848) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate.

Molecular Properties

Compound Namemethyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate
PubChem CID171872848
Molecular FormulaC12H15ClO5
Molecular Weight274.70 g/mol
Exact Mass274.06
IUPAC Namemethyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate
SMILESCOC(=O)c1cc(C(O)C(O)CCO)ccc1Cl
InChIInChI=1S/C12H15ClO5/c1-18-12(17)8-6-7(2-3-9(8)13)11(16)10(15)4-5-14/h2-3,6,10-11,14-16H,4-5H2,1H3
InChIKeyZRSLLEHIVPVPEZ-UHFFFAOYSA-N
XLogP0.90
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.70
LogP ≤ 50.90
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate?
The IUPAC name of methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate (CID 171872848) is methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate.
What is the SMILES notation for methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate?
The canonical SMILES for methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate is COC(=O)c1cc(C(O)C(O)CCO)ccc1Cl.
What is the InChIKey of methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate?
The InChIKey is ZRSLLEHIVPVPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO5/c1-18-12(17)8-6-7(2-3-9(8)13)11(16)10(15)4-5-14/h2-3,6,10-11,14-16H,4-5H2,1H3.
What are the key properties of methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate?
methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate has a molecular weight of 274.70 g/mol, XLogP of 0.90, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate is sourced from PubChem (CID 171872848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).