C12H15ClO5 — CID 171872848
methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate (PubChem CID 171872848) has the molecular formula C12H15ClO5 and a molecular weight of 274.70 g/mol. Its IUPAC name is methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate.
| Compound Name | methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate |
|---|---|
| PubChem CID | 171872848 |
| Molecular Formula | C12H15ClO5 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | methyl 2-chloro-5-(1,2,4-trihydroxybutyl)benzoate |
| SMILES | COC(=O)c1cc(C(O)C(O)CCO)ccc1Cl |
| InChI | InChI=1S/C12H15ClO5/c1-18-12(17)8-6-7(2-3-9(8)13)11(16)10(15)4-5-14/h2-3,6,10-11,14-16H,4-5H2,1H3 |
| InChIKey | ZRSLLEHIVPVPEZ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |