C12H15FO4S — CID 171874646
methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate (PubChem CID 171874646) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate.
| Compound Name | methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 171874646 |
| Molecular Formula | C12H15FO4S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(C(O)C(O)CCS)cc1F |
| InChI | InChI=1S/C12H15FO4S/c1-17-12(16)8-3-2-7(6-9(8)13)11(15)10(14)4-5-18/h2-3,6,10-11,14-15,18H,4-5H2,1H3 |
| InChIKey | UQLMQSTWOPFUPT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|