methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate

C12H15FO4S — CID 171874646

IUPACmethyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate
SMILESCOC(=O)c1ccc(C(O)C(O)CCS)cc1F
InChIInChI=1S/C12H15FO4S/c1-17-12(16)8-3-2-7(6-9(8)13)11(15)10(14)4-5-18/h2-3,6,10-11,14-15,18H,4-5H2,1H3
InChIKeyUQLMQSTWOPFUPT-UHFFFAOYSA-N
MW274.31 g/mol
LogP1.33
Rot. Bonds5

About methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate

methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate (PubChem CID 171874646) has the molecular formula C12H15FO4S and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate.

Molecular Properties

Compound Namemethyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate
PubChem CID171874646
Molecular FormulaC12H15FO4S
Molecular Weight274.31 g/mol
Exact Mass274.07
IUPAC Namemethyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate
SMILESCOC(=O)c1ccc(C(O)C(O)CCS)cc1F
InChIInChI=1S/C12H15FO4S/c1-17-12(16)8-3-2-7(6-9(8)13)11(15)10(14)4-5-18/h2-3,6,10-11,14-15,18H,4-5H2,1H3
InChIKeyUQLMQSTWOPFUPT-UHFFFAOYSA-N
XLogP1.33
TPSA66.76 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.31
LogP ≤ 51.33
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate?
The IUPAC name of methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate (CID 171874646) is methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate.
What is the SMILES notation for methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate?
The canonical SMILES for methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate is COC(=O)c1ccc(C(O)C(O)CCS)cc1F.
What is the InChIKey of methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate?
The InChIKey is UQLMQSTWOPFUPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15FO4S/c1-17-12(16)8-3-2-7(6-9(8)13)11(15)10(14)4-5-18/h2-3,6,10-11,14-15,18H,4-5H2,1H3.
What are the key properties of methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate?
methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate has a molecular weight of 274.31 g/mol, XLogP of 1.33, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1,2-dihydroxy-4-sulfanylbutyl)-2-fluorobenzoate is sourced from PubChem (CID 171874646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).