C14H17FO6 — CID 171897931
methyl 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoate (PubChem CID 171897931) has the molecular formula C14H17FO6 and a molecular weight of 300.28 g/mol. Its IUPAC name is methyl 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoate.
| Compound Name | methyl 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoate |
|---|---|
| PubChem CID | 171897931 |
| Molecular Formula | C14H17FO6 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | methyl 5-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2-fluorobenzoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(F)c(C(=O)OC)c1 |
| InChI | InChI=1S/C14H17FO6/c1-3-21-12(17)7-11(16)13(18)8-4-5-10(15)9(6-8)14(19)20-2/h4-6,11,13,16,18H,3,7H2,1-2H3 |
| InChIKey | APNBCGJUAKJUQQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |