C12H16O5 — CID 171896820
ethyl 3,4-dihydroxy-4-(4-hydroxyphenyl)butanoate (PubChem CID 171896820) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(4-hydroxyphenyl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(4-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 171896820 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(4-hydroxyphenyl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H16O5/c1-2-17-11(15)7-10(14)12(16)8-3-5-9(13)6-4-8/h3-6,10,12-14,16H,2,7H2,1H3 |
| InChIKey | ZMBOXUZYDMCUAI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |