C12H14BrFO4 — CID 171898467
ethyl 4-(4-bromo-3-fluorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171898467) has the molecular formula C12H14BrFO4 and a molecular weight of 321.14 g/mol. Its IUPAC name is ethyl 4-(4-bromo-3-fluorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(4-bromo-3-fluorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898467 |
| Molecular Formula | C12H14BrFO4 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | ethyl 4-(4-bromo-3-fluorophenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H14BrFO4/c1-2-18-11(16)6-10(15)12(17)7-3-4-8(13)9(14)5-7/h3-5,10,12,15,17H,2,6H2,1H3 |
| InChIKey | VKGKFKOOSWNOOJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |