C16H19BrFNO5 — CID 178130021
ethyl (3R)-3-(4-bromo-3-fluorophenyl)-3-[(3-ethoxy-3-oxopropanoyl)amino]propanoate (PubChem CID 178130021) has the molecular formula C16H19BrFNO5 and a molecular weight of 404.23 g/mol. Its IUPAC name is ethyl (3R)-3-(4-bromo-3-fluorophenyl)-3-[(3-ethoxy-3-oxopropanoyl)amino]propanoate.
| Compound Name | ethyl (3R)-3-(4-bromo-3-fluorophenyl)-3-[(3-ethoxy-3-oxopropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 178130021 |
| Molecular Formula | C16H19BrFNO5 |
| Molecular Weight | 404.23 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | ethyl (3R)-3-(4-bromo-3-fluorophenyl)-3-[(3-ethoxy-3-oxopropanoyl)amino]propanoate |
| SMILES | CCOC(=O)CC(=O)N[C@H](CC(=O)OCC)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C16H19BrFNO5/c1-3-23-15(21)8-13(10-5-6-11(17)12(18)7-10)19-14(20)9-16(22)24-4-2/h5-7,13H,3-4,8-9H2,1-2H3,(H,19,20)/t13-/m1/s1 |
| InChIKey | MQQJRLXXZVHYNN-CYBMUJFWSA-N |
| XLogP | 2.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|