C14H20BrClN2O3 — CID 119316759
ethyl 3-(3-aminopropanoylamino)-3-(4-bromophenyl)propanoate;hydrochloride (PubChem CID 119316759) has the molecular formula C14H20BrClN2O3 and a molecular weight of 379.68 g/mol. Its IUPAC name is ethyl 3-(3-aminopropanoylamino)-3-(4-bromophenyl)propanoate;hydrochloride.
| Compound Name | ethyl 3-(3-aminopropanoylamino)-3-(4-bromophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119316759 |
| Molecular Formula | C14H20BrClN2O3 |
| Molecular Weight | 379.68 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | ethyl 3-(3-aminopropanoylamino)-3-(4-bromophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(NC(=O)CCN)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C14H19BrN2O3.ClH/c1-2-20-14(19)9-12(17-13(18)7-8-16)10-3-5-11(15)6-4-10;/h3-6,12H,2,7-9,16H2,1H3,(H,17,18);1H |
| InChIKey | NPFAYYGDKSNPDF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.68 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |