C17H24BrClN2O3 — CID 119316763
ethyl 3-(4-bromophenyl)-3-(piperidine-4-carbonylamino)propanoate;hydrochloride (PubChem CID 119316763) has the molecular formula C17H24BrClN2O3 and a molecular weight of 419.75 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-3-(piperidine-4-carbonylamino)propanoate;hydrochloride.
| Compound Name | ethyl 3-(4-bromophenyl)-3-(piperidine-4-carbonylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119316763 |
| Molecular Formula | C17H24BrClN2O3 |
| Molecular Weight | 419.75 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-3-(piperidine-4-carbonylamino)propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(NC(=O)C1CCNCC1)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C17H23BrN2O3.ClH/c1-2-23-16(21)11-15(12-3-5-14(18)6-4-12)20-17(22)13-7-9-19-10-8-13;/h3-6,13,15,19H,2,7-11H2,1H3,(H,20,22);1H |
| InChIKey | MUEXDJCVNXVGAC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |