C18H26ClFN2O3 — CID 119755345
ethyl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(4-fluorophenyl)propanoate;hydrochloride (PubChem CID 119755345) has the molecular formula C18H26ClFN2O3 and a molecular weight of 372.87 g/mol. Its IUPAC name is ethyl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(4-fluorophenyl)propanoate;hydrochloride.
| Compound Name | ethyl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(4-fluorophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119755345 |
| Molecular Formula | C18H26ClFN2O3 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | ethyl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(4-fluorophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(NC(=O)C1CCCC(N)C1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C18H25FN2O3.ClH/c1-2-24-17(22)11-16(12-6-8-14(19)9-7-12)21-18(23)13-4-3-5-15(20)10-13;/h6-9,13,15-16H,2-5,10-11,20H2,1H3,(H,21,23);1H |
| InChIKey | ICNNMRVTLQKYEQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |