C20H30ClFN2O3 — CID 119755361
ethyl 3-(4-fluorophenyl)-3-(3-piperidin-4-ylbutanoylamino)propanoate;hydrochloride (PubChem CID 119755361) has the molecular formula C20H30ClFN2O3 and a molecular weight of 400.92 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-3-(3-piperidin-4-ylbutanoylamino)propanoate;hydrochloride.
| Compound Name | ethyl 3-(4-fluorophenyl)-3-(3-piperidin-4-ylbutanoylamino)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119755361 |
| Molecular Formula | C20H30ClFN2O3 |
| Molecular Weight | 400.92 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-3-(3-piperidin-4-ylbutanoylamino)propanoate;hydrochloride |
| SMILES | CCOC(=O)CC(NC(=O)CC(C)C1CCNCC1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C20H29FN2O3.ClH/c1-3-26-20(25)13-18(16-4-6-17(21)7-5-16)23-19(24)12-14(2)15-8-10-22-11-9-15;/h4-7,14-15,18,22H,3,8-13H2,1-2H3,(H,23,24);1H |
| InChIKey | CAFACFBMODOYJV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |