C16H20FNO3S2 — CID 102555402
ethyl 3-(1,4-dithiane-2-carbonylamino)-3-(4-fluorophenyl)propanoate (PubChem CID 102555402) has the molecular formula C16H20FNO3S2 and a molecular weight of 357.47 g/mol. Its IUPAC name is ethyl 3-(1,4-dithiane-2-carbonylamino)-3-(4-fluorophenyl)propanoate.
| Compound Name | ethyl 3-(1,4-dithiane-2-carbonylamino)-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 102555402 |
| Molecular Formula | C16H20FNO3S2 |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | ethyl 3-(1,4-dithiane-2-carbonylamino)-3-(4-fluorophenyl)propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C1CSCCS1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H20FNO3S2/c1-2-21-15(19)9-13(11-3-5-12(17)6-4-11)18-16(20)14-10-22-7-8-23-14/h3-6,13-14H,2,7-10H2,1H3,(H,18,20) |
| InChIKey | JSRHJZDMRDJWML-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |