C19H20FNO2S2 — CID 87004751
N-[2-(2-fluorophenoxy)-1-phenylethyl]-1,4-dithiane-2-carboxamide (PubChem CID 87004751) has the molecular formula C19H20FNO2S2 and a molecular weight of 377.51 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)-1-phenylethyl]-1,4-dithiane-2-carboxamide.
| Compound Name | N-[2-(2-fluorophenoxy)-1-phenylethyl]-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 87004751 |
| Molecular Formula | C19H20FNO2S2 |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[2-(2-fluorophenoxy)-1-phenylethyl]-1,4-dithiane-2-carboxamide |
| SMILES | O=C(NC(COc1ccccc1F)c1ccccc1)C1CSCCS1 |
| InChI | InChI=1S/C19H20FNO2S2/c20-15-8-4-5-9-17(15)23-12-16(14-6-2-1-3-7-14)21-19(22)18-13-24-10-11-25-18/h1-9,16,18H,10-13H2,(H,21,22) |
| InChIKey | YIYQOMSITMEBCF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |