C13H18N2OS2 — CID 119529464
N-(2-amino-2-phenylethyl)-1,4-dithiane-2-carboxamide (PubChem CID 119529464) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-1,4-dithiane-2-carboxamide.
| Compound Name | N-(2-amino-2-phenylethyl)-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 119529464 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-1,4-dithiane-2-carboxamide |
| SMILES | NC(CNC(=O)C1CSCCS1)c1ccccc1 |
| InChI | InChI=1S/C13H18N2OS2/c14-11(10-4-2-1-3-5-10)8-15-13(16)12-9-17-6-7-18-12/h1-5,11-12H,6-9,14H2,(H,15,16) |
| InChIKey | WKUNAAARVOOFHN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |