C14H19NOS2 — CID 112765567
N-(3-propan-2-ylphenyl)-1,4-dithiane-2-carboxamide (PubChem CID 112765567) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is N-(3-propan-2-ylphenyl)-1,4-dithiane-2-carboxamide.
| Compound Name | N-(3-propan-2-ylphenyl)-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112765567 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | N-(3-propan-2-ylphenyl)-1,4-dithiane-2-carboxamide |
| SMILES | CC(C)c1cccc(NC(=O)C2CSCCS2)c1 |
| InChI | InChI=1S/C14H19NOS2/c1-10(2)11-4-3-5-12(8-11)15-14(16)13-9-17-6-7-18-13/h3-5,8,10,13H,6-7,9H2,1-2H3,(H,15,16) |
| InChIKey | AXFNDJJICSKFJE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |