About N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide
N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide (PubChem CID 172505604) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide.
Molecular Properties
| Compound Name | N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide |
| PubChem CID | 172505604 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide |
| SMILES | CC(C)c1cccc(NC(=O)C2C3CC4CC3CC42)c1 |
| InChI | InChI=1S/C18H23NO/c1-10(2)11-4-3-5-14(7-11)19-18(20)17-15-8-12-6-13(15)9-16(12)17/h3-5,7,10,12-13,15-17H,6,8-9H2,1-2H3,(H,19,20) |
| InChIKey | QWXVRUZBLODSQM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide?
The IUPAC name of N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide (CID 172505604) is N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide.
What is the SMILES notation for N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide?
The canonical SMILES for N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide is CC(C)c1cccc(NC(=O)C2C3CC4CC3CC42)c1.
What is the InChIKey of N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide?
The InChIKey is QWXVRUZBLODSQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO/c1-10(2)11-4-3-5-14(7-11)19-18(20)17-15-8-12-6-13(15)9-16(12)17/h3-5,7,10,12-13,15-17H,6,8-9H2,1-2H3,(H,19,20).
What are the key properties of N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide?
N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide has a molecular weight of 269.39 g/mol, XLogP of 4.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-propan-2-ylphenyl)tricyclo[3.3.0.03,7]octane-2-carboxamide is sourced from PubChem (CID 172505604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).