C20H23N3O2S2 — CID 155946084
N-[3-[(2-amino-2-oxoethyl)-benzylamino]phenyl]-1,4-dithiane-2-carboxamide (PubChem CID 155946084) has the molecular formula C20H23N3O2S2 and a molecular weight of 401.56 g/mol. Its IUPAC name is N-[3-[(2-amino-2-oxoethyl)-benzylamino]phenyl]-1,4-dithiane-2-carboxamide.
| Compound Name | N-[3-[(2-amino-2-oxoethyl)-benzylamino]phenyl]-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 155946084 |
| Molecular Formula | C20H23N3O2S2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[3-[(2-amino-2-oxoethyl)-benzylamino]phenyl]-1,4-dithiane-2-carboxamide |
| SMILES | NC(=O)CN(Cc1ccccc1)c1cccc(NC(=O)C2CSCCS2)c1 |
| InChI | InChI=1S/C20H23N3O2S2/c21-19(24)13-23(12-15-5-2-1-3-6-15)17-8-4-7-16(11-17)22-20(25)18-14-26-9-10-27-18/h1-8,11,18H,9-10,12-14H2,(H2,21,24)(H,22,25) |
| InChIKey | GDSCRVPMHIOWMN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |