C17H23NO3S2 — CID 120536393
4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid (PubChem CID 120536393) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid.
| Compound Name | 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 120536393 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid |
| SMILES | O=C(O)CCCN(Cc1ccccc1)C(=O)CC1CSCCS1 |
| InChI | InChI=1S/C17H23NO3S2/c19-16(11-15-13-22-9-10-23-15)18(8-4-7-17(20)21)12-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,20,21) |
| InChIKey | XHQAQXQVIUDHNM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |