4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid

C17H23NO3S2 — CID 120536393

IUPAC4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCN(Cc1ccccc1)C(=O)CC1CSCCS1
InChIInChI=1S/C17H23NO3S2/c19-16(11-15-13-22-9-10-23-15)18(8-4-7-17(20)21)12-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,20,21)
InChIKeyXHQAQXQVIUDHNM-UHFFFAOYSA-N
MW353.51 g/mol
LogP3.12
Rot. Bonds8

About 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid

4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid (PubChem CID 120536393) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid.

Molecular Properties

Compound Name4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid
PubChem CID120536393
Molecular FormulaC17H23NO3S2
Molecular Weight353.51 g/mol
Exact Mass353.11
IUPAC Name4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCN(Cc1ccccc1)C(=O)CC1CSCCS1
InChIInChI=1S/C17H23NO3S2/c19-16(11-15-13-22-9-10-23-15)18(8-4-7-17(20)21)12-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,20,21)
InChIKeyXHQAQXQVIUDHNM-UHFFFAOYSA-N
XLogP3.12
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500353.51
LogP ≤ 53.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid?
The IUPAC name of 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid (CID 120536393) is 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid.
What is the SMILES notation for 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid?
The canonical SMILES for 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid is O=C(O)CCCN(Cc1ccccc1)C(=O)CC1CSCCS1.
What is the InChIKey of 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid?
The InChIKey is XHQAQXQVIUDHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3S2/c19-16(11-15-13-22-9-10-23-15)18(8-4-7-17(20)21)12-14-5-2-1-3-6-14/h1-3,5-6,15H,4,7-13H2,(H,20,21).
What are the key properties of 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid?
4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid has a molecular weight of 353.51 g/mol, XLogP of 3.12, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[benzyl-[2-(1,4-dithian-2-yl)acetyl]amino]butanoic acid is sourced from PubChem (CID 120536393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).